C16H14Br2 — CID 141458589
2,7-dibromo-10,10-dimethyl-9H-anthracene (PubChem CID 141458589) has the molecular formula C16H14Br2 and a molecular weight of 366.10 g/mol. Its IUPAC name is 2,7-dibromo-10,10-dimethyl-9H-anthracene.
| Compound Name | 2,7-dibromo-10,10-dimethyl-9H-anthracene |
|---|---|
| PubChem CID | 141458589 |
| Molecular Formula | C16H14Br2 |
| Molecular Weight | 366.10 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | 2,7-dibromo-10,10-dimethyl-9H-anthracene |
| SMILES | CC1(C)c2ccc(Br)cc2Cc2cc(Br)ccc21 |
| InChI | InChI=1S/C16H14Br2/c1-16(2)14-5-3-12(17)8-10(14)7-11-9-13(18)4-6-15(11)16/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | DPZMIKGQCZIHRJ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.10 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |