About 6-bromospiro[1H-indene-3,3'-thietane]-2-one
6-bromospiro[1H-indene-3,3'-thietane]-2-one (PubChem CID 58221476) has the molecular formula C11H9BrOS
and a molecular weight of 269.16 g/mol. Its IUPAC name is 6-bromospiro[1H-indene-3,3'-thietane]-2-one.
Molecular Properties
| Compound Name | 6-bromospiro[1H-indene-3,3'-thietane]-2-one |
| PubChem CID | 58221476 |
| Molecular Formula | C11H9BrOS |
| Molecular Weight | 269.16 g/mol |
| Exact Mass | 267.96 |
| IUPAC Name | 6-bromospiro[1H-indene-3,3'-thietane]-2-one |
| SMILES | O=C1Cc2cc(Br)ccc2C12CSC2 |
| InChI | InChI=1S/C11H9BrOS/c12-8-1-2-9-7(3-8)4-10(13)11(9)5-14-6-11/h1-3H,4-6H2 |
| InChIKey | NNWWQLGNHKHKOV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.16 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromospiro[1H-indene-3,3'-thietane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromospiro[1H-indene-3,3'-thietane]-2-one?
The IUPAC name of 6-bromospiro[1H-indene-3,3'-thietane]-2-one (CID 58221476) is 6-bromospiro[1H-indene-3,3'-thietane]-2-one.
What is the SMILES notation for 6-bromospiro[1H-indene-3,3'-thietane]-2-one?
The canonical SMILES for 6-bromospiro[1H-indene-3,3'-thietane]-2-one is O=C1Cc2cc(Br)ccc2C12CSC2.
What is the InChIKey of 6-bromospiro[1H-indene-3,3'-thietane]-2-one?
The InChIKey is NNWWQLGNHKHKOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BrOS/c12-8-1-2-9-7(3-8)4-10(13)11(9)5-14-6-11/h1-3H,4-6H2.
What are the key properties of 6-bromospiro[1H-indene-3,3'-thietane]-2-one?
6-bromospiro[1H-indene-3,3'-thietane]-2-one has a molecular weight of 269.16 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromospiro[1H-indene-3,3'-thietane]-2-one is sourced from PubChem (CID 58221476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).