C11H9BrOS — CID 58221476
6-bromospiro[1H-indene-3,3'-thietane]-2-one (PubChem CID 58221476) has the molecular formula C11H9BrOS and a molecular weight of 269.16 g/mol. Its IUPAC name is 6-bromospiro[1H-indene-3,3'-thietane]-2-one.
| Compound Name | 6-bromospiro[1H-indene-3,3'-thietane]-2-one |
|---|---|
| PubChem CID | 58221476 |
| Molecular Formula | C11H9BrOS |
| Molecular Weight | 269.16 g/mol |
| Exact Mass | 267.96 |
| IUPAC Name | 6-bromospiro[1H-indene-3,3'-thietane]-2-one |
| SMILES | O=C1Cc2cc(Br)ccc2C12CSC2 |
| InChI | InChI=1S/C11H9BrOS/c12-8-1-2-9-7(3-8)4-10(13)11(9)5-14-6-11/h1-3H,4-6H2 |
| InChIKey | NNWWQLGNHKHKOV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.16 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |