About 6-bromo-3,3-diethyl-1H-inden-2-one
6-bromo-3,3-diethyl-1H-inden-2-one (PubChem CID 58375843) has the molecular formula C13H15BrO
and a molecular weight of 267.17 g/mol. Its IUPAC name is 6-bromo-3,3-diethyl-1H-inden-2-one.
Molecular Properties
| Compound Name | 6-bromo-3,3-diethyl-1H-inden-2-one |
| PubChem CID | 58375843 |
| Molecular Formula | C13H15BrO |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 6-bromo-3,3-diethyl-1H-inden-2-one |
| SMILES | CCC1(CC)C(=O)Cc2cc(Br)ccc21 |
| InChI | InChI=1S/C13H15BrO/c1-3-13(4-2)11-6-5-10(14)7-9(11)8-12(13)15/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | HAASMZSJAHNQAY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-3,3-diethyl-1H-inden-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3,3-diethyl-1H-inden-2-one?
The IUPAC name of 6-bromo-3,3-diethyl-1H-inden-2-one (CID 58375843) is 6-bromo-3,3-diethyl-1H-inden-2-one.
What is the SMILES notation for 6-bromo-3,3-diethyl-1H-inden-2-one?
The canonical SMILES for 6-bromo-3,3-diethyl-1H-inden-2-one is CCC1(CC)C(=O)Cc2cc(Br)ccc21.
What is the InChIKey of 6-bromo-3,3-diethyl-1H-inden-2-one?
The InChIKey is HAASMZSJAHNQAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrO/c1-3-13(4-2)11-6-5-10(14)7-9(11)8-12(13)15/h5-7H,3-4,8H2,1-2H3.
What are the key properties of 6-bromo-3,3-diethyl-1H-inden-2-one?
6-bromo-3,3-diethyl-1H-inden-2-one has a molecular weight of 267.17 g/mol, XLogP of 3.63, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3,3-diethyl-1H-inden-2-one is sourced from PubChem (CID 58375843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).