About 5-bromo-5'-ethoxyspiro[1,3-dihydroindene-2,2'-cyclohexane]-1'-one
5-bromo-5'-ethoxyspiro[1,3-dihydroindene-2,2'-cyclohexane]-1'-one (PubChem CID 67984264) has the molecular formula C16H19BrO2
and a molecular weight of 323.23 g/mol. Its IUPAC name is 5-bromo-5'-ethoxyspiro[1,3-dihydroindene-2,2'-cyclohexane]-1'-one.
Molecular Properties
| Compound Name | 5-bromo-5'-ethoxyspiro[1,3-dihydroindene-2,2'-cyclohexane]-1'-one |
| PubChem CID | 67984264 |
| Molecular Formula | C16H19BrO2 |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 5-bromo-5'-ethoxyspiro[1,3-dihydroindene-2,2'-cyclohexane]-1'-one |
| SMILES | CCOC1CCC2(Cc3ccc(Br)cc3C2)C(=O)C1 |
| InChI | InChI=1S/C16H19BrO2/c1-2-19-14-5-6-16(15(18)8-14)9-11-3-4-13(17)7-12(11)10-16/h3-4,7,14H,2,5-6,8-10H2,1H3 |
| InChIKey | NVFNAEJXKQXPQB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-5'-ethoxyspiro[1,3-dihydroindene-2,2'-cyclohexane]-1'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-5'-ethoxyspiro[1,3-dihydroindene-2,2'-cyclohexane]-1'-one?
The IUPAC name of 5-bromo-5'-ethoxyspiro[1,3-dihydroindene-2,2'-cyclohexane]-1'-one (CID 67984264) is 5-bromo-5'-ethoxyspiro[1,3-dihydroindene-2,2'-cyclohexane]-1'-one.
What is the SMILES notation for 5-bromo-5'-ethoxyspiro[1,3-dihydroindene-2,2'-cyclohexane]-1'-one?
The canonical SMILES for 5-bromo-5'-ethoxyspiro[1,3-dihydroindene-2,2'-cyclohexane]-1'-one is CCOC1CCC2(Cc3ccc(Br)cc3C2)C(=O)C1.
What is the InChIKey of 5-bromo-5'-ethoxyspiro[1,3-dihydroindene-2,2'-cyclohexane]-1'-one?
The InChIKey is NVFNAEJXKQXPQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19BrO2/c1-2-19-14-5-6-16(15(18)8-14)9-11-3-4-13(17)7-12(11)10-16/h3-4,7,14H,2,5-6,8-10H2,1H3.
What are the key properties of 5-bromo-5'-ethoxyspiro[1,3-dihydroindene-2,2'-cyclohexane]-1'-one?
5-bromo-5'-ethoxyspiro[1,3-dihydroindene-2,2'-cyclohexane]-1'-one has a molecular weight of 323.23 g/mol, XLogP of 3.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-5'-ethoxyspiro[1,3-dihydroindene-2,2'-cyclohexane]-1'-one is sourced from PubChem (CID 67984264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).