C19H23BrN2OS — CID 88539519
CID 88539519 (PubChem CID 88539519) has the molecular formula C19H23BrN2OS and a molecular weight of 407.38 g/mol.
| Compound Name | CID 88539519 |
|---|---|
| PubChem CID | 88539519 |
| Molecular Formula | C19H23BrN2OS |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | — |
| SMILES | CCOC1CCC2(CC1)Cc1ccc(Br)cc1C21N=C(C)C(=S)N1 |
| InChI | InChI=1S/C19H23BrN2OS/c1-3-23-15-6-8-18(9-7-15)11-13-4-5-14(20)10-16(13)19(18)21-12(2)17(24)22-19/h4-5,10,15H,3,6-9,11H2,1-2H3,(H,22,24) |
| InChIKey | QWBNLHLOKYPYKK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|