C12H11BrN2OS — CID 86667268
6'-bromo-4-methylspiro[1H-imidazole-2,4'-2,3-dihydrochromene]-5-thione (PubChem CID 86667268) has the molecular formula C12H11BrN2OS and a molecular weight of 311.20 g/mol. Its IUPAC name is 6'-bromo-4-methylspiro[1H-imidazole-2,4'-2,3-dihydrochromene]-5-thione.
| Compound Name | 6'-bromo-4-methylspiro[1H-imidazole-2,4'-2,3-dihydrochromene]-5-thione |
|---|---|
| PubChem CID | 86667268 |
| Molecular Formula | C12H11BrN2OS |
| Molecular Weight | 311.20 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | 6'-bromo-4-methylspiro[1H-imidazole-2,4'-2,3-dihydrochromene]-5-thione |
| SMILES | CC1=NC2(CCOc3ccc(Br)cc32)NC1=S |
| InChI | InChI=1S/C12H11BrN2OS/c1-7-11(17)15-12(14-7)4-5-16-10-3-2-8(13)6-9(10)12/h2-3,6H,4-5H2,1H3,(H,15,17) |
| InChIKey | AWSZJNXEMQQYBL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.20 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|