C10H10BrNOS — CID 87064570
6-bromo-4,4-dimethyl-3H-1,3-benzoxazine-2-thione (PubChem CID 87064570) has the molecular formula C10H10BrNOS and a molecular weight of 272.17 g/mol. Its IUPAC name is 6-bromo-4,4-dimethyl-3H-1,3-benzoxazine-2-thione.
| Compound Name | 6-bromo-4,4-dimethyl-3H-1,3-benzoxazine-2-thione |
|---|---|
| PubChem CID | 87064570 |
| Molecular Formula | C10H10BrNOS |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 270.97 |
| IUPAC Name | 6-bromo-4,4-dimethyl-3H-1,3-benzoxazine-2-thione |
| SMILES | CC1(C)NC(=S)Oc2ccc(Br)cc21 |
| InChI | InChI=1S/C10H10BrNOS/c1-10(2)7-5-6(11)3-4-8(7)13-9(14)12-10/h3-5H,1-2H3,(H,12,14) |
| InChIKey | IDCWKWZOZXQHOQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|