C8H7BrO2 — CID 67447010
(2S)-5-bromo-2-methyl-1,3-benzodioxole (PubChem CID 67447010) has the molecular formula C8H7BrO2 and a molecular weight of 215.05 g/mol. Its IUPAC name is (2S)-5-bromo-2-methyl-1,3-benzodioxole.
| Compound Name | (2S)-5-bromo-2-methyl-1,3-benzodioxole |
|---|---|
| PubChem CID | 67447010 |
| Molecular Formula | C8H7BrO2 |
| Molecular Weight | 215.05 g/mol |
| Exact Mass | 213.96 |
| IUPAC Name | (2S)-5-bromo-2-methyl-1,3-benzodioxole |
| SMILES | C[C@H]1Oc2ccc(Br)cc2O1 |
| InChI | InChI=1S/C8H7BrO2/c1-5-10-7-3-2-6(9)4-8(7)11-5/h2-5H,1H3/t5-/m0/s1 |
| InChIKey | DEKJXAHLKGDILF-YFKPBYRVSA-N |
| XLogP | 2.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.05 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |