C13H15BrO — CID 139297124
8-bromo-2-methyl-1,2,3,4,4a,9b-hexahydrodibenzofuran (PubChem CID 139297124) has the molecular formula C13H15BrO and a molecular weight of 267.17 g/mol. Its IUPAC name is 8-bromo-2-methyl-1,2,3,4,4a,9b-hexahydrodibenzofuran.
| Compound Name | 8-bromo-2-methyl-1,2,3,4,4a,9b-hexahydrodibenzofuran |
|---|---|
| PubChem CID | 139297124 |
| Molecular Formula | C13H15BrO |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 8-bromo-2-methyl-1,2,3,4,4a,9b-hexahydrodibenzofuran |
| SMILES | CC1CCC2Oc3ccc(Br)cc3C2C1 |
| InChI | InChI=1S/C13H15BrO/c1-8-2-4-12-10(6-8)11-7-9(14)3-5-13(11)15-12/h3,5,7-8,10,12H,2,4,6H2,1H3 |
| InChIKey | ZGSIWILQJOGKFH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |