C16H21BrO2 — CID 104951316
(4S)-6-bromo-2-(4-methylcyclohexyl)-3,4-dihydro-2H-chromen-4-ol (PubChem CID 104951316) has the molecular formula C16H21BrO2 and a molecular weight of 325.25 g/mol. Its IUPAC name is (4S)-6-bromo-2-(4-methylcyclohexyl)-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4S)-6-bromo-2-(4-methylcyclohexyl)-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 104951316 |
| Molecular Formula | C16H21BrO2 |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | (4S)-6-bromo-2-(4-methylcyclohexyl)-3,4-dihydro-2H-chromen-4-ol |
| SMILES | CC1CCC(C2C[C@H](O)c3cc(Br)ccc3O2)CC1 |
| InChI | InChI=1S/C16H21BrO2/c1-10-2-4-11(5-3-10)16-9-14(18)13-8-12(17)6-7-15(13)19-16/h6-8,10-11,14,16,18H,2-5,9H2,1H3/t10?,11?,14-,16?/m0/s1 |
| InChIKey | JPXUXXCGQBMXES-XRDQEZKRSA-N |
| XLogP | 4.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |