C17H24O3 — CID 114715458
6-methoxy-2-(4-methylcyclohexyl)-3,4-dihydro-2H-chromen-4-ol (PubChem CID 114715458) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 6-methoxy-2-(4-methylcyclohexyl)-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 6-methoxy-2-(4-methylcyclohexyl)-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 114715458 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 6-methoxy-2-(4-methylcyclohexyl)-3,4-dihydro-2H-chromen-4-ol |
| SMILES | COc1ccc2c(c1)C(O)CC(C1CCC(C)CC1)O2 |
| InChI | InChI=1S/C17H24O3/c1-11-3-5-12(6-4-11)17-10-15(18)14-9-13(19-2)7-8-16(14)20-17/h7-9,11-12,15,17-18H,3-6,10H2,1-2H3 |
| InChIKey | HROMBDJVMWHAEW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |