C16H23NO2 — CID 104947068
(4R)-2-cyclohexyl-6-methoxy-3,4-dihydro-2H-chromen-4-amine (PubChem CID 104947068) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is (4R)-2-cyclohexyl-6-methoxy-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4R)-2-cyclohexyl-6-methoxy-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 104947068 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (4R)-2-cyclohexyl-6-methoxy-3,4-dihydro-2H-chromen-4-amine |
| SMILES | COc1ccc2c(c1)[C@H](N)CC(C1CCCCC1)O2 |
| InChI | InChI=1S/C16H23NO2/c1-18-12-7-8-15-13(9-12)14(17)10-16(19-15)11-5-3-2-4-6-11/h7-9,11,14,16H,2-6,10,17H2,1H3/t14-,16?/m1/s1 |
| InChIKey | PTNRUEMQEWDXSP-IURRXHLWSA-N |
| XLogP | 3.43 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |