C12H17NO2 — CID 114709859
2-ethyl-6-methoxy-3,4-dihydro-2H-chromen-4-amine (PubChem CID 114709859) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-ethyl-6-methoxy-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 2-ethyl-6-methoxy-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 114709859 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-ethyl-6-methoxy-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CCC1CC(N)c2cc(OC)ccc2O1 |
| InChI | InChI=1S/C12H17NO2/c1-3-8-7-11(13)10-6-9(14-2)4-5-12(10)15-8/h4-6,8,11H,3,7,13H2,1-2H3 |
| InChIKey | ZDSLAPLPQVWBBC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |