C14H21NO2S — CID 104944582
(4S)-2-(2-ethylsulfanylethyl)-7-methoxy-3,4-dihydro-2H-chromen-4-amine (PubChem CID 104944582) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is (4S)-2-(2-ethylsulfanylethyl)-7-methoxy-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4S)-2-(2-ethylsulfanylethyl)-7-methoxy-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 104944582 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (4S)-2-(2-ethylsulfanylethyl)-7-methoxy-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CCSCCC1C[C@H](N)c2ccc(OC)cc2O1 |
| InChI | InChI=1S/C14H21NO2S/c1-3-18-7-6-11-8-13(15)12-5-4-10(16-2)9-14(12)17-11/h4-5,9,11,13H,3,6-8,15H2,1-2H3/t11?,13-/m0/s1 |
| InChIKey | OFULWGQZQCISBH-YUZLPWPTSA-N |
| XLogP | 2.99 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|