C17H27NO2 — CID 104946961
(4R)-2-heptyl-6-methoxy-3,4-dihydro-2H-chromen-4-amine (PubChem CID 104946961) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is (4R)-2-heptyl-6-methoxy-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4R)-2-heptyl-6-methoxy-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 104946961 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | (4R)-2-heptyl-6-methoxy-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CCCCCCCC1C[C@@H](N)c2cc(OC)ccc2O1 |
| InChI | InChI=1S/C17H27NO2/c1-3-4-5-6-7-8-14-12-16(18)15-11-13(19-2)9-10-17(15)20-14/h9-11,14,16H,3-8,12,18H2,1-2H3/t14?,16-/m1/s1 |
| InChIKey | KBMRCKQXDZEHQW-BZSJEYESSA-N |
| XLogP | 4.21 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|