C16H24FNO — CID 104947821
(4R)-7-fluoro-2-heptyl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 104947821) has the molecular formula C16H24FNO and a molecular weight of 265.37 g/mol. Its IUPAC name is (4R)-7-fluoro-2-heptyl-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4R)-7-fluoro-2-heptyl-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 104947821 |
| Molecular Formula | C16H24FNO |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | (4R)-7-fluoro-2-heptyl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CCCCCCCC1C[C@@H](N)c2ccc(F)cc2O1 |
| InChI | InChI=1S/C16H24FNO/c1-2-3-4-5-6-7-13-11-15(18)14-9-8-12(17)10-16(14)19-13/h8-10,13,15H,2-7,11,18H2,1H3/t13?,15-/m1/s1 |
| InChIKey | IQGVOPNWMVJNQM-AWKYBWMHSA-N |
| XLogP | 4.34 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|