C17H25NO2 — CID 104947122
(4R)-2-(cyclohexylmethyl)-6-methoxy-3,4-dihydro-2H-chromen-4-amine (PubChem CID 104947122) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is (4R)-2-(cyclohexylmethyl)-6-methoxy-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4R)-2-(cyclohexylmethyl)-6-methoxy-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 104947122 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | (4R)-2-(cyclohexylmethyl)-6-methoxy-3,4-dihydro-2H-chromen-4-amine |
| SMILES | COc1ccc2c(c1)[C@H](N)CC(CC1CCCCC1)O2 |
| InChI | InChI=1S/C17H25NO2/c1-19-13-7-8-17-15(10-13)16(18)11-14(20-17)9-12-5-3-2-4-6-12/h7-8,10,12,14,16H,2-6,9,11,18H2,1H3/t14?,16-/m1/s1 |
| InChIKey | XAJQAIBGWMBJNM-BZSJEYESSA-N |
| XLogP | 3.82 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |