C18H24O3 — CID 103277996
(4S)-2-(3,5-dimethylcyclohex-3-en-1-yl)-6-methoxy-3,4-dihydro-2H-chromen-4-ol (PubChem CID 103277996) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is (4S)-2-(3,5-dimethylcyclohex-3-en-1-yl)-6-methoxy-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4S)-2-(3,5-dimethylcyclohex-3-en-1-yl)-6-methoxy-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 103277996 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (4S)-2-(3,5-dimethylcyclohex-3-en-1-yl)-6-methoxy-3,4-dihydro-2H-chromen-4-ol |
| SMILES | COc1ccc2c(c1)[C@@H](O)CC(C1CC(C)=CC(C)C1)O2 |
| InChI | InChI=1S/C18H24O3/c1-11-6-12(2)8-13(7-11)18-10-16(19)15-9-14(20-3)4-5-17(15)21-18/h4-6,9,11,13,16,18-19H,7-8,10H2,1-3H3/t11?,13?,16-,18?/m0/s1 |
| InChIKey | BJCVWAQIVIUFSJ-JFIDHQHDSA-N |
| XLogP | 3.87 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|