C18H25NO2 — CID 103278012
2-(3,5-dimethylcyclohex-3-en-1-yl)-7-methoxy-3,4-dihydro-2H-chromen-4-amine (PubChem CID 103278012) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 2-(3,5-dimethylcyclohex-3-en-1-yl)-7-methoxy-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 2-(3,5-dimethylcyclohex-3-en-1-yl)-7-methoxy-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 103278012 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 2-(3,5-dimethylcyclohex-3-en-1-yl)-7-methoxy-3,4-dihydro-2H-chromen-4-amine |
| SMILES | COc1ccc2c(c1)OC(C1CC(C)=CC(C)C1)CC2N |
| InChI | InChI=1S/C18H25NO2/c1-11-6-12(2)8-13(7-11)17-10-16(19)15-5-4-14(20-3)9-18(15)21-17/h4-6,9,11,13,16-17H,7-8,10,19H2,1-3H3 |
| InChIKey | VAOIUPCEDIAMKN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|