C17H22ClNO — CID 103278027
(4S)-6-chloro-2-(3,5-dimethylcyclohex-3-en-1-yl)-3,4-dihydro-2H-chromen-4-amine (PubChem CID 103278027) has the molecular formula C17H22ClNO and a molecular weight of 291.82 g/mol. Its IUPAC name is (4S)-6-chloro-2-(3,5-dimethylcyclohex-3-en-1-yl)-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4S)-6-chloro-2-(3,5-dimethylcyclohex-3-en-1-yl)-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 103278027 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (4S)-6-chloro-2-(3,5-dimethylcyclohex-3-en-1-yl)-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CC1=CC(C)CC(C2C[C@H](N)c3cc(Cl)ccc3O2)C1 |
| InChI | InChI=1S/C17H22ClNO/c1-10-5-11(2)7-12(6-10)17-9-15(19)14-8-13(18)3-4-16(14)20-17/h3-5,8,10,12,15,17H,6-7,9,19H2,1-2H3/t10?,12?,15-,17?/m0/s1 |
| InChIKey | BMKRGGUWQDDRDO-GGCLSOKZSA-N |
| XLogP | 4.48 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|