C13H16ClNOS — CID 107133991
(4R)-6-chloro-2-(thiolan-3-yl)-3,4-dihydro-2H-chromen-4-amine (PubChem CID 107133991) has the molecular formula C13H16ClNOS and a molecular weight of 269.80 g/mol. Its IUPAC name is (4R)-6-chloro-2-(thiolan-3-yl)-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4R)-6-chloro-2-(thiolan-3-yl)-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 107133991 |
| Molecular Formula | C13H16ClNOS |
| Molecular Weight | 269.80 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | (4R)-6-chloro-2-(thiolan-3-yl)-3,4-dihydro-2H-chromen-4-amine |
| SMILES | N[C@@H]1CC(C2CCSC2)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C13H16ClNOS/c14-9-1-2-12-10(5-9)11(15)6-13(16-12)8-3-4-17-7-8/h1-2,5,8,11,13H,3-4,6-7,15H2/t8?,11-,13?/m1/s1 |
| InChIKey | DTYBFMKFYIDSBL-UHLWVNKISA-N |
| XLogP | 3.24 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.80 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |