C13H15ClO2 — CID 114714497
6-chloro-2-cyclobutyl-3,4-dihydro-2H-chromen-4-ol (PubChem CID 114714497) has the molecular formula C13H15ClO2 and a molecular weight of 238.71 g/mol. Its IUPAC name is 6-chloro-2-cyclobutyl-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 6-chloro-2-cyclobutyl-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 114714497 |
| Molecular Formula | C13H15ClO2 |
| Molecular Weight | 238.71 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 6-chloro-2-cyclobutyl-3,4-dihydro-2H-chromen-4-ol |
| SMILES | OC1CC(C2CCC2)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C13H15ClO2/c14-9-4-5-12-10(6-9)11(15)7-13(16-12)8-2-1-3-8/h4-6,8,11,13,15H,1-3,7H2 |
| InChIKey | PDXLJELDRUNCNH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.71 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |