C16H21FO2 — CID 114714168
2-cycloheptyl-6-fluoro-3,4-dihydro-2H-chromen-4-ol (PubChem CID 114714168) has the molecular formula C16H21FO2 and a molecular weight of 264.34 g/mol. Its IUPAC name is 2-cycloheptyl-6-fluoro-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 2-cycloheptyl-6-fluoro-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 114714168 |
| Molecular Formula | C16H21FO2 |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-cycloheptyl-6-fluoro-3,4-dihydro-2H-chromen-4-ol |
| SMILES | OC1CC(C2CCCCCC2)Oc2ccc(F)cc21 |
| InChI | InChI=1S/C16H21FO2/c17-12-7-8-15-13(9-12)14(18)10-16(19-15)11-5-3-1-2-4-6-11/h7-9,11,14,16,18H,1-6,10H2 |
| InChIKey | CPDLXQIGHYZGGH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |