C14H17FO2 — CID 114715832
2-cyclopentyl-7-fluoro-3,4-dihydro-2H-chromen-4-ol (PubChem CID 114715832) has the molecular formula C14H17FO2 and a molecular weight of 236.29 g/mol. Its IUPAC name is 2-cyclopentyl-7-fluoro-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 2-cyclopentyl-7-fluoro-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 114715832 |
| Molecular Formula | C14H17FO2 |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2-cyclopentyl-7-fluoro-3,4-dihydro-2H-chromen-4-ol |
| SMILES | OC1CC(C2CCCC2)Oc2cc(F)ccc21 |
| InChI | InChI=1S/C14H17FO2/c15-10-5-6-11-12(16)8-13(17-14(11)7-10)9-3-1-2-4-9/h5-7,9,12-13,16H,1-4,8H2 |
| InChIKey | RJWFURFORPWKLO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |