C14H17FO3 — CID 104951765
(4R)-7-fluoro-2-(5-methyloxolan-2-yl)-3,4-dihydro-2H-chromen-4-ol (PubChem CID 104951765) has the molecular formula C14H17FO3 and a molecular weight of 252.28 g/mol. Its IUPAC name is (4R)-7-fluoro-2-(5-methyloxolan-2-yl)-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4R)-7-fluoro-2-(5-methyloxolan-2-yl)-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 104951765 |
| Molecular Formula | C14H17FO3 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | (4R)-7-fluoro-2-(5-methyloxolan-2-yl)-3,4-dihydro-2H-chromen-4-ol |
| SMILES | CC1CCC(C2C[C@@H](O)c3ccc(F)cc3O2)O1 |
| InChI | InChI=1S/C14H17FO3/c1-8-2-5-12(17-8)14-7-11(16)10-4-3-9(15)6-13(10)18-14/h3-4,6,8,11-12,14,16H,2,5,7H2,1H3/t8?,11-,12?,14?/m1/s1 |
| InChIKey | XIJHQDZYGUOHRW-CNOLRNJVSA-N |
| XLogP | 2.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |