C13H15FO3 — CID 114715803
7-fluoro-2-(oxolan-3-yl)-3,4-dihydro-2H-chromen-4-ol (PubChem CID 114715803) has the molecular formula C13H15FO3 and a molecular weight of 238.26 g/mol. Its IUPAC name is 7-fluoro-2-(oxolan-3-yl)-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 7-fluoro-2-(oxolan-3-yl)-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 114715803 |
| Molecular Formula | C13H15FO3 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 7-fluoro-2-(oxolan-3-yl)-3,4-dihydro-2H-chromen-4-ol |
| SMILES | OC1CC(C2CCOC2)Oc2cc(F)ccc21 |
| InChI | InChI=1S/C13H15FO3/c14-9-1-2-10-11(15)6-12(17-13(10)5-9)8-3-4-16-7-8/h1-2,5,8,11-12,15H,3-4,6-7H2 |
| InChIKey | HQMQUYDGZLBDEV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |