About 7-fluoro-4-hydroxy-3,4-dihydro-2H-chromene-2-carboxylic acid
7-fluoro-4-hydroxy-3,4-dihydro-2H-chromene-2-carboxylic acid (PubChem CID 122235955) has the molecular formula C10H9FO4
and a molecular weight of 212.18 g/mol. Its IUPAC name is 7-fluoro-4-hydroxy-3,4-dihydro-2H-chromene-2-carboxylic acid.
Analyze 7-fluoro-4-hydroxy-3,4-dihydro-2H-chromene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-4-hydroxy-3,4-dihydro-2H-chromene-2-carboxylic acid?
The IUPAC name of 7-fluoro-4-hydroxy-3,4-dihydro-2H-chromene-2-carboxylic acid (CID 122235955) is 7-fluoro-4-hydroxy-3,4-dihydro-2H-chromene-2-carboxylic acid.
What is the SMILES notation for 7-fluoro-4-hydroxy-3,4-dihydro-2H-chromene-2-carboxylic acid?
The canonical SMILES for 7-fluoro-4-hydroxy-3,4-dihydro-2H-chromene-2-carboxylic acid is O=C(O)C1CC(O)c2ccc(F)cc2O1.
What is the InChIKey of 7-fluoro-4-hydroxy-3,4-dihydro-2H-chromene-2-carboxylic acid?
The InChIKey is SEWNLOQYCUTBTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FO4/c11-5-1-2-6-7(12)4-9(10(13)14)15-8(6)3-5/h1-3,7,9,12H,4H2,(H,13,14).
What are the key properties of 7-fluoro-4-hydroxy-3,4-dihydro-2H-chromene-2-carboxylic acid?
7-fluoro-4-hydroxy-3,4-dihydro-2H-chromene-2-carboxylic acid has a molecular weight of 212.18 g/mol, XLogP of 1.09, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-4-hydroxy-3,4-dihydro-2H-chromene-2-carboxylic acid is sourced from PubChem (CID 122235955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).