About 2-ethyl-7-fluoro-3,4-dihydro-2H-chromen-4-ol
2-ethyl-7-fluoro-3,4-dihydro-2H-chromen-4-ol (PubChem CID 114715755) has the molecular formula C11H13FO2
and a molecular weight of 196.22 g/mol. Its IUPAC name is 2-ethyl-7-fluoro-3,4-dihydro-2H-chromen-4-ol.
Molecular Properties
| Compound Name | 2-ethyl-7-fluoro-3,4-dihydro-2H-chromen-4-ol |
| PubChem CID | 114715755 |
| Molecular Formula | C11H13FO2 |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 2-ethyl-7-fluoro-3,4-dihydro-2H-chromen-4-ol |
| SMILES | CCC1CC(O)c2ccc(F)cc2O1 |
| InChI | InChI=1S/C11H13FO2/c1-2-8-6-10(13)9-4-3-7(12)5-11(9)14-8/h3-5,8,10,13H,2,6H2,1H3 |
| InChIKey | OGMLJUJGAQYJBL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-7-fluoro-3,4-dihydro-2H-chromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-7-fluoro-3,4-dihydro-2H-chromen-4-ol?
The IUPAC name of 2-ethyl-7-fluoro-3,4-dihydro-2H-chromen-4-ol (CID 114715755) is 2-ethyl-7-fluoro-3,4-dihydro-2H-chromen-4-ol.
What is the SMILES notation for 2-ethyl-7-fluoro-3,4-dihydro-2H-chromen-4-ol?
The canonical SMILES for 2-ethyl-7-fluoro-3,4-dihydro-2H-chromen-4-ol is CCC1CC(O)c2ccc(F)cc2O1.
What is the InChIKey of 2-ethyl-7-fluoro-3,4-dihydro-2H-chromen-4-ol?
The InChIKey is OGMLJUJGAQYJBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FO2/c1-2-8-6-10(13)9-4-3-7(12)5-11(9)14-8/h3-5,8,10,13H,2,6H2,1H3.
What are the key properties of 2-ethyl-7-fluoro-3,4-dihydro-2H-chromen-4-ol?
2-ethyl-7-fluoro-3,4-dihydro-2H-chromen-4-ol has a molecular weight of 196.22 g/mol, XLogP of 2.42, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-7-fluoro-3,4-dihydro-2H-chromen-4-ol is sourced from PubChem (CID 114715755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).