C11H14O5S — CID 129115211
2-ethyl-4-hydroxy-3,4-dihydro-2H-chromene-7-sulfonic acid (PubChem CID 129115211) has the molecular formula C11H14O5S and a molecular weight of 258.29 g/mol. Its IUPAC name is 2-ethyl-4-hydroxy-3,4-dihydro-2H-chromene-7-sulfonic acid.
| Compound Name | 2-ethyl-4-hydroxy-3,4-dihydro-2H-chromene-7-sulfonic acid |
|---|---|
| PubChem CID | 129115211 |
| Molecular Formula | C11H14O5S |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-ethyl-4-hydroxy-3,4-dihydro-2H-chromene-7-sulfonic acid |
| SMILES | CCC1CC(O)c2ccc(S(=O)(=O)O)cc2O1 |
| InChI | InChI=1S/C11H14O5S/c1-2-7-5-10(12)9-4-3-8(17(13,14)15)6-11(9)16-7/h3-4,6-7,10,12H,2,5H2,1H3,(H,13,14,15) |
| InChIKey | CEQJGDMMWOENHA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|