About 2-ethyl-4-hydroxy-3,4-dihydro-2H-chromene-7-sulfonic acid
2-ethyl-4-hydroxy-3,4-dihydro-2H-chromene-7-sulfonic acid (PubChem CID 129115211) has the molecular formula C11H14O5S
and a molecular weight of 258.29 g/mol. Its IUPAC name is 2-ethyl-4-hydroxy-3,4-dihydro-2H-chromene-7-sulfonic acid.
Molecular Properties
| Compound Name | 2-ethyl-4-hydroxy-3,4-dihydro-2H-chromene-7-sulfonic acid |
| PubChem CID | 129115211 |
| Molecular Formula | C11H14O5S |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-ethyl-4-hydroxy-3,4-dihydro-2H-chromene-7-sulfonic acid |
| SMILES | CCC1CC(O)c2ccc(S(=O)(=O)O)cc2O1 |
| InChI | InChI=1S/C11H14O5S/c1-2-7-5-10(12)9-4-3-8(17(13,14)15)6-11(9)16-7/h3-4,6-7,10,12H,2,5H2,1H3,(H,13,14,15) |
| InChIKey | CEQJGDMMWOENHA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-4-hydroxy-3,4-dihydro-2H-chromene-7-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-hydroxy-3,4-dihydro-2H-chromene-7-sulfonic acid?
The IUPAC name of 2-ethyl-4-hydroxy-3,4-dihydro-2H-chromene-7-sulfonic acid (CID 129115211) is 2-ethyl-4-hydroxy-3,4-dihydro-2H-chromene-7-sulfonic acid.
What is the SMILES notation for 2-ethyl-4-hydroxy-3,4-dihydro-2H-chromene-7-sulfonic acid?
The canonical SMILES for 2-ethyl-4-hydroxy-3,4-dihydro-2H-chromene-7-sulfonic acid is CCC1CC(O)c2ccc(S(=O)(=O)O)cc2O1.
What is the InChIKey of 2-ethyl-4-hydroxy-3,4-dihydro-2H-chromene-7-sulfonic acid?
The InChIKey is CEQJGDMMWOENHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O5S/c1-2-7-5-10(12)9-4-3-8(17(13,14)15)6-11(9)16-7/h3-4,6-7,10,12H,2,5H2,1H3,(H,13,14,15).
What are the key properties of 2-ethyl-4-hydroxy-3,4-dihydro-2H-chromene-7-sulfonic acid?
2-ethyl-4-hydroxy-3,4-dihydro-2H-chromene-7-sulfonic acid has a molecular weight of 258.29 g/mol, XLogP of 1.53, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-hydroxy-3,4-dihydro-2H-chromene-7-sulfonic acid is sourced from PubChem (CID 129115211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).