C10H12O3 — CID 104950006
(4S)-2-(hydroxymethyl)-3,4-dihydro-2H-chromen-4-ol (PubChem CID 104950006) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is (4S)-2-(hydroxymethyl)-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4S)-2-(hydroxymethyl)-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 104950006 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | (4S)-2-(hydroxymethyl)-3,4-dihydro-2H-chromen-4-ol |
| SMILES | OCC1C[C@H](O)c2ccccc2O1 |
| InChI | InChI=1S/C10H12O3/c11-6-7-5-9(12)8-3-1-2-4-10(8)13-7/h1-4,7,9,11-12H,5-6H2/t7?,9-/m0/s1 |
| InChIKey | IEQIKWXHMYQYJL-NETXQHHPSA-N |
| XLogP | 0.86 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |