About 2-butan-2-yl-3,4-dihydro-2H-chromen-4-ol
2-butan-2-yl-3,4-dihydro-2H-chromen-4-ol (PubChem CID 114714846) has the molecular formula C13H18O2
and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-butan-2-yl-3,4-dihydro-2H-chromen-4-ol.
Molecular Properties
| Compound Name | 2-butan-2-yl-3,4-dihydro-2H-chromen-4-ol |
| PubChem CID | 114714846 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2-butan-2-yl-3,4-dihydro-2H-chromen-4-ol |
| SMILES | CCC(C)C1CC(O)c2ccccc2O1 |
| InChI | InChI=1S/C13H18O2/c1-3-9(2)13-8-11(14)10-6-4-5-7-12(10)15-13/h4-7,9,11,13-14H,3,8H2,1-2H3 |
| InChIKey | UODVZKXYWVTABE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butan-2-yl-3,4-dihydro-2H-chromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yl-3,4-dihydro-2H-chromen-4-ol?
The IUPAC name of 2-butan-2-yl-3,4-dihydro-2H-chromen-4-ol (CID 114714846) is 2-butan-2-yl-3,4-dihydro-2H-chromen-4-ol.
What is the SMILES notation for 2-butan-2-yl-3,4-dihydro-2H-chromen-4-ol?
The canonical SMILES for 2-butan-2-yl-3,4-dihydro-2H-chromen-4-ol is CCC(C)C1CC(O)c2ccccc2O1.
What is the InChIKey of 2-butan-2-yl-3,4-dihydro-2H-chromen-4-ol?
The InChIKey is UODVZKXYWVTABE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-3-9(2)13-8-11(14)10-6-4-5-7-12(10)15-13/h4-7,9,11,13-14H,3,8H2,1-2H3.
What are the key properties of 2-butan-2-yl-3,4-dihydro-2H-chromen-4-ol?
2-butan-2-yl-3,4-dihydro-2H-chromen-4-ol has a molecular weight of 206.29 g/mol, XLogP of 2.92, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-3,4-dihydro-2H-chromen-4-ol is sourced from PubChem (CID 114714846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).