C13H18O2 — CID 114714846
2-butan-2-yl-3,4-dihydro-2H-chromen-4-ol (PubChem CID 114714846) has the molecular formula C13H18O2 and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-butan-2-yl-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 2-butan-2-yl-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 114714846 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2-butan-2-yl-3,4-dihydro-2H-chromen-4-ol |
| SMILES | CCC(C)C1CC(O)c2ccccc2O1 |
| InChI | InChI=1S/C13H18O2/c1-3-9(2)13-8-11(14)10-6-4-5-7-12(10)15-13/h4-7,9,11,13-14H,3,8H2,1-2H3 |
| InChIKey | UODVZKXYWVTABE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |