C14H20O2 — CID 104949803
(4S)-2-pentan-3-yl-3,4-dihydro-2H-chromen-4-ol (PubChem CID 104949803) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (4S)-2-pentan-3-yl-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4S)-2-pentan-3-yl-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 104949803 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (4S)-2-pentan-3-yl-3,4-dihydro-2H-chromen-4-ol |
| SMILES | CCC(CC)C1C[C@H](O)c2ccccc2O1 |
| InChI | InChI=1S/C14H20O2/c1-3-10(4-2)14-9-12(15)11-7-5-6-8-13(11)16-14/h5-8,10,12,14-15H,3-4,9H2,1-2H3/t12-,14?/m0/s1 |
| InChIKey | BOOMPQSILCNGCE-NBFOIZRFSA-N |
| XLogP | 3.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |