About (4R)-2-pentan-3-yl-3,4-dihydro-2H-chromen-4-amine
(4R)-2-pentan-3-yl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 104946122) has the molecular formula C14H21NO
and a molecular weight of 219.33 g/mol. Its IUPAC name is (4R)-2-pentan-3-yl-3,4-dihydro-2H-chromen-4-amine.
Molecular Properties
| Compound Name | (4R)-2-pentan-3-yl-3,4-dihydro-2H-chromen-4-amine |
| PubChem CID | 104946122 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (4R)-2-pentan-3-yl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CCC(CC)C1C[C@@H](N)c2ccccc2O1 |
| InChI | InChI=1S/C14H21NO/c1-3-10(4-2)14-9-12(15)11-7-5-6-8-13(11)16-14/h5-8,10,12,14H,3-4,9,15H2,1-2H3/t12-,14?/m1/s1 |
| InChIKey | KYALNVJJOTXCIU-PUODRLBUSA-N |
| XLogP | 3.27 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-2-pentan-3-yl-3,4-dihydro-2H-chromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2-pentan-3-yl-3,4-dihydro-2H-chromen-4-amine?
The IUPAC name of (4R)-2-pentan-3-yl-3,4-dihydro-2H-chromen-4-amine (CID 104946122) is (4R)-2-pentan-3-yl-3,4-dihydro-2H-chromen-4-amine.
What is the SMILES notation for (4R)-2-pentan-3-yl-3,4-dihydro-2H-chromen-4-amine?
The canonical SMILES for (4R)-2-pentan-3-yl-3,4-dihydro-2H-chromen-4-amine is CCC(CC)C1C[C@@H](N)c2ccccc2O1.
What is the InChIKey of (4R)-2-pentan-3-yl-3,4-dihydro-2H-chromen-4-amine?
The InChIKey is KYALNVJJOTXCIU-PUODRLBUSA-N. The full InChI is InChI=1S/C14H21NO/c1-3-10(4-2)14-9-12(15)11-7-5-6-8-13(11)16-14/h5-8,10,12,14H,3-4,9,15H2,1-2H3/t12-,14?/m1/s1.
What are the key properties of (4R)-2-pentan-3-yl-3,4-dihydro-2H-chromen-4-amine?
(4R)-2-pentan-3-yl-3,4-dihydro-2H-chromen-4-amine has a molecular weight of 219.33 g/mol, XLogP of 3.27, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2-pentan-3-yl-3,4-dihydro-2H-chromen-4-amine is sourced from PubChem (CID 104946122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).