C9H10ClNO — CID 141093967
(2R,4R)-2-chloro-3,4-dihydro-2H-chromen-4-amine (PubChem CID 141093967) has the molecular formula C9H10ClNO and a molecular weight of 183.64 g/mol. Its IUPAC name is (2R,4R)-2-chloro-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (2R,4R)-2-chloro-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 141093967 |
| Molecular Formula | C9H10ClNO |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | (2R,4R)-2-chloro-3,4-dihydro-2H-chromen-4-amine |
| SMILES | N[C@@H]1C[C@@H](Cl)Oc2ccccc21 |
| InChI | InChI=1S/C9H10ClNO/c10-9-5-7(11)6-3-1-2-4-8(6)12-9/h1-4,7,9H,5,11H2/t7-,9+/m1/s1 |
| InChIKey | FAMADPIAHUOEJJ-APPZFPTMSA-N |
| XLogP | 2.03 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|