C13H13NOS — CID 104946079
(4R)-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 104946079) has the molecular formula C13H13NOS and a molecular weight of 231.32 g/mol. Its IUPAC name is (4R)-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4R)-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 104946079 |
| Molecular Formula | C13H13NOS |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | (4R)-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | N[C@@H]1CC(c2cccs2)Oc2ccccc21 |
| InChI | InChI=1S/C13H13NOS/c14-10-8-12(13-6-3-7-16-13)15-11-5-2-1-4-9(10)11/h1-7,10,12H,8,14H2/t10-,12?/m1/s1 |
| InChIKey | CNNDRBADMFVQLI-RWANSRKNSA-N |
| XLogP | 3.27 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |