C13H12BrNOS — CID 114709140
7-bromo-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 114709140) has the molecular formula C13H12BrNOS and a molecular weight of 310.22 g/mol. Its IUPAC name is 7-bromo-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 7-bromo-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 114709140 |
| Molecular Formula | C13H12BrNOS |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | 7-bromo-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | NC1CC(c2cccs2)Oc2cc(Br)ccc21 |
| InChI | InChI=1S/C13H12BrNOS/c14-8-3-4-9-10(15)7-12(16-11(9)6-8)13-2-1-5-17-13/h1-6,10,12H,7,15H2 |
| InChIKey | VHVMWMDBCSCHTP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |