C15H13BrClNO — CID 104946067
(4R)-2-(2-bromo-5-chlorophenyl)-3,4-dihydro-2H-chromen-4-amine (PubChem CID 104946067) has the molecular formula C15H13BrClNO and a molecular weight of 338.63 g/mol. Its IUPAC name is (4R)-2-(2-bromo-5-chlorophenyl)-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4R)-2-(2-bromo-5-chlorophenyl)-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 104946067 |
| Molecular Formula | C15H13BrClNO |
| Molecular Weight | 338.63 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | (4R)-2-(2-bromo-5-chlorophenyl)-3,4-dihydro-2H-chromen-4-amine |
| SMILES | N[C@@H]1CC(c2cc(Cl)ccc2Br)Oc2ccccc21 |
| InChI | InChI=1S/C15H13BrClNO/c16-12-6-5-9(17)7-11(12)15-8-13(18)10-3-1-2-4-14(10)19-15/h1-7,13,15H,8,18H2/t13-,15?/m1/s1 |
| InChIKey | VJZHGPBUWRJHBT-AFYYWNPRSA-N |
| XLogP | 4.63 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |