C19H17NO — CID 104946162
(4R)-2-naphthalen-1-yl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 104946162) has the molecular formula C19H17NO and a molecular weight of 275.35 g/mol. Its IUPAC name is (4R)-2-naphthalen-1-yl-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4R)-2-naphthalen-1-yl-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 104946162 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (4R)-2-naphthalen-1-yl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | N[C@@H]1CC(c2cccc3ccccc23)Oc2ccccc21 |
| InChI | InChI=1S/C19H17NO/c20-17-12-19(21-18-11-4-3-9-16(17)18)15-10-5-7-13-6-1-2-8-14(13)15/h1-11,17,19H,12,20H2/t17-,19?/m1/s1 |
| InChIKey | JPLADVGMDBGVCH-DUSLRRAJSA-N |
| XLogP | 4.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |