C15H17NOS — CID 114712166
N-ethyl-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 114712166) has the molecular formula C15H17NOS and a molecular weight of 259.37 g/mol. Its IUPAC name is N-ethyl-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | N-ethyl-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 114712166 |
| Molecular Formula | C15H17NOS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-ethyl-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CCNC1CC(c2cccs2)Oc2ccccc21 |
| InChI | InChI=1S/C15H17NOS/c1-2-16-12-10-14(15-8-5-9-18-15)17-13-7-4-3-6-11(12)13/h3-9,12,14,16H,2,10H2,1H3 |
| InChIKey | QIMPQXKGXOJSCF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |