About (2S,4S)-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-ol
(2S,4S)-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-ol (PubChem CID 92935771) has the molecular formula C13H12O2S
and a molecular weight of 232.30 g/mol. Its IUPAC name is (2S,4S)-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-ol.
Molecular Properties
| Compound Name | (2S,4S)-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-ol |
| PubChem CID | 92935771 |
| Molecular Formula | C13H12O2S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | (2S,4S)-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-ol |
| SMILES | O[C@H]1C[C@@H](c2cccs2)Oc2ccccc21 |
| InChI | InChI=1S/C13H12O2S/c14-10-8-12(13-6-3-7-16-13)15-11-5-2-1-4-9(10)11/h1-7,10,12,14H,8H2/t10-,12-/m0/s1 |
| InChIKey | GLYJKQPNTAQVDC-JQWIXIFHSA-N |
| XLogP | 3.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,4S)-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4S)-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-ol?
The IUPAC name of (2S,4S)-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-ol (CID 92935771) is (2S,4S)-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-ol.
What is the SMILES notation for (2S,4S)-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-ol?
The canonical SMILES for (2S,4S)-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-ol is O[C@H]1C[C@@H](c2cccs2)Oc2ccccc21.
What is the InChIKey of (2S,4S)-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-ol?
The InChIKey is GLYJKQPNTAQVDC-JQWIXIFHSA-N. The full InChI is InChI=1S/C13H12O2S/c14-10-8-12(13-6-3-7-16-13)15-11-5-2-1-4-9(10)11/h1-7,10,12,14H,8H2/t10-,12-/m0/s1.
What are the key properties of (2S,4S)-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-ol?
(2S,4S)-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-ol has a molecular weight of 232.30 g/mol, XLogP of 3.31, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S)-2-thiophen-2-yl-3,4-dihydro-2H-chromen-4-ol is sourced from PubChem (CID 92935771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).