C14H14O2S — CID 104949769
(4S)-2-(3-methylthiophen-2-yl)-3,4-dihydro-2H-chromen-4-ol (PubChem CID 104949769) has the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. Its IUPAC name is (4S)-2-(3-methylthiophen-2-yl)-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4S)-2-(3-methylthiophen-2-yl)-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 104949769 |
| Molecular Formula | C14H14O2S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | (4S)-2-(3-methylthiophen-2-yl)-3,4-dihydro-2H-chromen-4-ol |
| SMILES | Cc1ccsc1C1C[C@H](O)c2ccccc2O1 |
| InChI | InChI=1S/C14H14O2S/c1-9-6-7-17-14(9)13-8-11(15)10-4-2-3-5-12(10)16-13/h2-7,11,13,15H,8H2,1H3/t11-,13?/m0/s1 |
| InChIKey | ZKLHJUVZOTUJEN-AMGKYWFPSA-N |
| XLogP | 3.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |