C16H15FO2 — CID 114715039
2-(3-fluoro-4-methylphenyl)-3,4-dihydro-2H-chromen-4-ol (PubChem CID 114715039) has the molecular formula C16H15FO2 and a molecular weight of 258.29 g/mol. Its IUPAC name is 2-(3-fluoro-4-methylphenyl)-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 2-(3-fluoro-4-methylphenyl)-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 114715039 |
| Molecular Formula | C16H15FO2 |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 2-(3-fluoro-4-methylphenyl)-3,4-dihydro-2H-chromen-4-ol |
| SMILES | Cc1ccc(C2CC(O)c3ccccc3O2)cc1F |
| InChI | InChI=1S/C16H15FO2/c1-10-6-7-11(8-13(10)17)16-9-14(18)12-4-2-3-5-15(12)19-16/h2-8,14,16,18H,9H2,1H3 |
| InChIKey | DGDVRBLPIZZKOA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |