C16H14O4 — CID 11277233
(2S,4S)-2-(1,3-benzodioxol-5-yl)-3,4-dihydro-2H-chromen-4-ol (PubChem CID 11277233) has the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. Its IUPAC name is (2S,4S)-2-(1,3-benzodioxol-5-yl)-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (2S,4S)-2-(1,3-benzodioxol-5-yl)-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 11277233 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (2S,4S)-2-(1,3-benzodioxol-5-yl)-3,4-dihydro-2H-chromen-4-ol |
| SMILES | O[C@H]1C[C@@H](c2ccc3c(c2)OCO3)Oc2ccccc21 |
| InChI | InChI=1S/C16H14O4/c17-12-8-15(20-13-4-2-1-3-11(12)13)10-5-6-14-16(7-10)19-9-18-14/h1-7,12,15,17H,8-9H2/t12-,15-/m0/s1 |
| InChIKey | CYLMMNOLWBQRTI-WFASDCNBSA-N |
| XLogP | 2.97 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |