C15H12O4 — CID 57131096
3-(1,3-benzodioxol-5-yl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 57131096) has the molecular formula C15H12O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 57131096 |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | c1ccc2c(c1)OCC(c1ccc3c(c1)OCO3)O2 |
| InChI | InChI=1S/C15H12O4/c1-2-4-13-11(3-1)16-8-15(19-13)10-5-6-12-14(7-10)18-9-17-12/h1-7,15H,8-9H2 |
| InChIKey | NFFLBAUSGYHUPG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |