C11H12O3 — CID 10035471
5-(oxolan-2-yl)-1,3-benzodioxole (PubChem CID 10035471) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is 5-(oxolan-2-yl)-1,3-benzodioxole.
| Compound Name | 5-(oxolan-2-yl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 10035471 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 5-(oxolan-2-yl)-1,3-benzodioxole |
| SMILES | c1cc2c(cc1C1CCCO1)OCO2 |
| InChI | InChI=1S/C11H12O3/c1-2-9(12-5-1)8-3-4-10-11(6-8)14-7-13-10/h3-4,6,9H,1-2,5,7H2 |
| InChIKey | QCJOBFOJNSHFBZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |