C10H11NO3 — CID 71380359
2-(1,3-benzodioxol-5-yl)-1,3-oxazolidine (PubChem CID 71380359) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1,3-oxazolidine.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 71380359 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1,3-oxazolidine |
| SMILES | c1cc2c(cc1C1NCCO1)OCO2 |
| InChI | InChI=1S/C10H11NO3/c1-2-8-9(14-6-13-8)5-7(1)10-11-3-4-12-10/h1-2,5,10-11H,3-4,6H2 |
| InChIKey | GUADOUHDTOMTOH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |