C14H10ClNO3 — CID 2806671
2-(1,3-benzodioxol-5-yl)-5-chloro-2,3-dihydro-1,3-benzoxazole (PubChem CID 2806671) has the molecular formula C14H10ClNO3 and a molecular weight of 275.69 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-5-chloro-2,3-dihydro-1,3-benzoxazole.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-5-chloro-2,3-dihydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 2806671 |
| Molecular Formula | C14H10ClNO3 |
| Molecular Weight | 275.69 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-5-chloro-2,3-dihydro-1,3-benzoxazole |
| SMILES | Clc1ccc2c(c1)NC(c1ccc3c(c1)OCO3)O2 |
| InChI | InChI=1S/C14H10ClNO3/c15-9-2-4-11-10(6-9)16-14(19-11)8-1-3-12-13(5-8)18-7-17-12/h1-6,14,16H,7H2 |
| InChIKey | PMDAXBPIDQDLPQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.69 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |