C18H14N4O4S2 — CID 39320078
(1R,5S)-1,5-bis(1,3-benzodioxol-5-yl)-1,2,5,6-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione (PubChem CID 39320078) has the molecular formula C18H14N4O4S2 and a molecular weight of 414.47 g/mol. Its IUPAC name is (1R,5S)-1,5-bis(1,3-benzodioxol-5-yl)-1,2,5,6-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione.
| Compound Name | (1R,5S)-1,5-bis(1,3-benzodioxol-5-yl)-1,2,5,6-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione |
|---|---|
| PubChem CID | 39320078 |
| Molecular Formula | C18H14N4O4S2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | (1R,5S)-1,5-bis(1,3-benzodioxol-5-yl)-1,2,5,6-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione |
| SMILES | S=C1N[C@@H](c2ccc3c(c2)OCO3)N2C(=S)N[C@H](c3ccc4c(c3)OCO4)N12 |
| InChI | InChI=1S/C18H14N4O4S2/c27-17-19-15(9-1-3-11-13(5-9)25-7-23-11)21-18(28)20-16(22(17)21)10-2-4-12-14(6-10)26-8-24-12/h1-6,15-16H,7-8H2,(H,19,27)(H,20,28)/t15-,16+ |
| InChIKey | ZIZHXWVTJPAWMN-IYBDPMFKSA-N |
| XLogP | 2.14 |
| TPSA | 67.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|