C22H16N2O5 — CID 26435725
(2R)-2,3-bis(1,3-benzodioxol-5-yl)-1,2-dihydroquinazolin-4-one (PubChem CID 26435725) has the molecular formula C22H16N2O5 and a molecular weight of 388.38 g/mol. Its IUPAC name is (2R)-2,3-bis(1,3-benzodioxol-5-yl)-1,2-dihydroquinazolin-4-one.
| Compound Name | (2R)-2,3-bis(1,3-benzodioxol-5-yl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 26435725 |
| Molecular Formula | C22H16N2O5 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (2R)-2,3-bis(1,3-benzodioxol-5-yl)-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2N[C@@H](c2ccc3c(c2)OCO3)N1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H16N2O5/c25-22-15-3-1-2-4-16(15)23-21(13-5-7-17-19(9-13)28-11-26-17)24(22)14-6-8-18-20(10-14)29-12-27-18/h1-10,21,23H,11-12H2/t21-/m1/s1 |
| InChIKey | VGUIUWFHIDMHCS-OAQYLSRUSA-N |
| XLogP | 3.92 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |