C10H9N3O3 — CID 79962095
4-amino-5-(1,3-benzodioxol-5-yl)-1,5-dihydroimidazol-2-one (PubChem CID 79962095) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is 4-amino-5-(1,3-benzodioxol-5-yl)-1,5-dihydroimidazol-2-one.
| Compound Name | 4-amino-5-(1,3-benzodioxol-5-yl)-1,5-dihydroimidazol-2-one |
|---|---|
| PubChem CID | 79962095 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 4-amino-5-(1,3-benzodioxol-5-yl)-1,5-dihydroimidazol-2-one |
| SMILES | NC1=NC(=O)NC1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H9N3O3/c11-9-8(12-10(14)13-9)5-1-2-6-7(3-5)16-4-15-6/h1-3,8H,4H2,(H3,11,12,13,14) |
| InChIKey | GLRJDVQSXPBSTI-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |